C16H14BrCl3N2S2 — CID 100599457
1-(4-bromo-3-chlorophenyl)-3-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]thiourea (PubChem CID 100599457) has the molecular formula C16H14BrCl3N2S2 and a molecular weight of 484.70 g/mol. Its IUPAC name is 1-(4-bromo-3-chlorophenyl)-3-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]thiourea.
| Compound Name | 1-(4-bromo-3-chlorophenyl)-3-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]thiourea |
|---|---|
| PubChem CID | 100599457 |
| Molecular Formula | C16H14BrCl3N2S2 |
| Molecular Weight | 484.70 g/mol |
| Exact Mass | 481.88 |
| IUPAC Name | 1-(4-bromo-3-chlorophenyl)-3-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]thiourea |
| SMILES | S=C(NCCSCc1ccc(Cl)c(Cl)c1)Nc1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C16H14BrCl3N2S2/c17-12-3-2-11(8-14(12)19)22-16(23)21-5-6-24-9-10-1-4-13(18)15(20)7-10/h1-4,7-8H,5-6,9H2,(H2,21,22,23) |
| InChIKey | XQYGYKGFRPVDGP-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.70 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|