C10H10Cl2N2O2S — CID 2826683
3-[(3,4-dichlorophenyl)carbamothioylamino]propanoic acid (PubChem CID 2826683) has the molecular formula C10H10Cl2N2O2S and a molecular weight of 293.18 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)carbamothioylamino]propanoic acid.
| Compound Name | 3-[(3,4-dichlorophenyl)carbamothioylamino]propanoic acid |
|---|---|
| PubChem CID | 2826683 |
| Molecular Formula | C10H10Cl2N2O2S |
| Molecular Weight | 293.18 g/mol |
| Exact Mass | 291.98 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)carbamothioylamino]propanoic acid |
| SMILES | O=C(O)CCNC(=S)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H10Cl2N2O2S/c11-7-2-1-6(5-8(7)12)14-10(17)13-4-3-9(15)16/h1-2,5H,3-4H2,(H,15,16)(H2,13,14,17) |
| InChIKey | XAQLHUKSPBNFKP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.18 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|