C13H8Cl4N2S — CID 4763349
1,3-bis(3,4-dichlorophenyl)thiourea (PubChem CID 4763349) has the molecular formula C13H8Cl4N2S and a molecular weight of 366.10 g/mol. Its IUPAC name is 1,3-bis(3,4-dichlorophenyl)thiourea.
| Compound Name | 1,3-bis(3,4-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 4763349 |
| Molecular Formula | C13H8Cl4N2S |
| Molecular Weight | 366.10 g/mol |
| Exact Mass | 363.92 |
| IUPAC Name | 1,3-bis(3,4-dichlorophenyl)thiourea |
| SMILES | S=C(Nc1ccc(Cl)c(Cl)c1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H8Cl4N2S/c14-9-3-1-7(5-11(9)16)18-13(20)19-8-2-4-10(15)12(17)6-8/h1-6H,(H2,18,19,20) |
| InChIKey | ADTNKNCYYPRXIW-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.10 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|