C19H22Cl2N2S — CID 19687858
1-(3,4-dichlorophenyl)-3-[2,6-di(propan-2-yl)phenyl]thiourea (PubChem CID 19687858) has the molecular formula C19H22Cl2N2S and a molecular weight of 381.37 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[2,6-di(propan-2-yl)phenyl]thiourea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[2,6-di(propan-2-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 19687858 |
| Molecular Formula | C19H22Cl2N2S |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[2,6-di(propan-2-yl)phenyl]thiourea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=S)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H22Cl2N2S/c1-11(2)14-6-5-7-15(12(3)4)18(14)23-19(24)22-13-8-9-16(20)17(21)10-13/h5-12H,1-4H3,(H2,22,23,24) |
| InChIKey | INCCATXOJQENKJ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|