C14H10Cl2N2O2S — CID 17381526
3-[(3,4-dichlorophenyl)carbamothioylamino]benzoic acid (PubChem CID 17381526) has the molecular formula C14H10Cl2N2O2S and a molecular weight of 341.22 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)carbamothioylamino]benzoic acid.
| Compound Name | 3-[(3,4-dichlorophenyl)carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 17381526 |
| Molecular Formula | C14H10Cl2N2O2S |
| Molecular Weight | 341.22 g/mol |
| Exact Mass | 339.98 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)carbamothioylamino]benzoic acid |
| SMILES | O=C(O)c1cccc(NC(=S)Nc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C14H10Cl2N2O2S/c15-11-5-4-10(7-12(11)16)18-14(21)17-9-3-1-2-8(6-9)13(19)20/h1-7H,(H,19,20)(H2,17,18,21) |
| InChIKey | OORCKAGPYLEENA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.22 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|