C14H11Cl2N3OS — CID 4198960
1-(benzenecarbonothioylamino)-3-(3,4-dichlorophenyl)urea (PubChem CID 4198960) has the molecular formula C14H11Cl2N3OS and a molecular weight of 340.24 g/mol. Its IUPAC name is 1-(benzenecarbonothioylamino)-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-(benzenecarbonothioylamino)-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 4198960 |
| Molecular Formula | C14H11Cl2N3OS |
| Molecular Weight | 340.24 g/mol |
| Exact Mass | 339.00 |
| IUPAC Name | 1-(benzenecarbonothioylamino)-3-(3,4-dichlorophenyl)urea |
| SMILES | O=C(NNC(=S)c1ccccc1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H11Cl2N3OS/c15-11-7-6-10(8-12(11)16)17-14(20)19-18-13(21)9-4-2-1-3-5-9/h1-8H,(H,18,21)(H2,17,19,20) |
| InChIKey | DRVKOSNMACPDFD-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.24 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|