C14H11Cl2N3O — CID 125466393
1-[amino(phenyl)methylidene]-3-(3,4-dichlorophenyl)urea (PubChem CID 125466393) has the molecular formula C14H11Cl2N3O and a molecular weight of 308.17 g/mol. Its IUPAC name is 1-[amino(phenyl)methylidene]-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-[amino(phenyl)methylidene]-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 125466393 |
| Molecular Formula | C14H11Cl2N3O |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 1-[amino(phenyl)methylidene]-3-(3,4-dichlorophenyl)urea |
| SMILES | NC(=NC(=O)Nc1ccc(Cl)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C14H11Cl2N3O/c15-11-7-6-10(8-12(11)16)18-14(20)19-13(17)9-4-2-1-3-5-9/h1-8H,(H3,17,18,19,20) |
| InChIKey | SPGJAOMZNUZJDL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|