C22H15Cl4N3O2 — CID 121264483
N-[2-[[amino(phenyl)methylidene]amino]-1-(3,4-dichlorophenyl)-2-oxoethyl]-3,5-dichlorobenzamide (PubChem CID 121264483) has the molecular formula C22H15Cl4N3O2 and a molecular weight of 495.19 g/mol. Its IUPAC name is N-[2-[[amino(phenyl)methylidene]amino]-1-(3,4-dichlorophenyl)-2-oxoethyl]-3,5-dichlorobenzamide.
| Compound Name | N-[2-[[amino(phenyl)methylidene]amino]-1-(3,4-dichlorophenyl)-2-oxoethyl]-3,5-dichlorobenzamide |
|---|---|
| PubChem CID | 121264483 |
| Molecular Formula | C22H15Cl4N3O2 |
| Molecular Weight | 495.19 g/mol |
| Exact Mass | 492.99 |
| IUPAC Name | N-[2-[[amino(phenyl)methylidene]amino]-1-(3,4-dichlorophenyl)-2-oxoethyl]-3,5-dichlorobenzamide |
| SMILES | N/C(=N\C(=O)C(NC(=O)c1cc(Cl)cc(Cl)c1)c1ccc(Cl)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C22H15Cl4N3O2/c23-15-8-14(9-16(24)11-15)21(30)28-19(13-6-7-17(25)18(26)10-13)22(31)29-20(27)12-4-2-1-3-5-12/h1-11,19H,(H,28,30)(H2,27,29,31) |
| InChIKey | WKTRHBNBBJUCLI-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.19 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|