C22H18ClN3O2 — CID 121264156
N-[2-[[amino(phenyl)methylidene]amino]-2-oxo-1-phenylethyl]-4-chlorobenzamide (PubChem CID 121264156) has the molecular formula C22H18ClN3O2 and a molecular weight of 391.86 g/mol. Its IUPAC name is N-[2-[[amino(phenyl)methylidene]amino]-2-oxo-1-phenylethyl]-4-chlorobenzamide.
| Compound Name | N-[2-[[amino(phenyl)methylidene]amino]-2-oxo-1-phenylethyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 121264156 |
| Molecular Formula | C22H18ClN3O2 |
| Molecular Weight | 391.86 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | N-[2-[[amino(phenyl)methylidene]amino]-2-oxo-1-phenylethyl]-4-chlorobenzamide |
| SMILES | N/C(=N\C(=O)C(NC(=O)c1ccc(Cl)cc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H18ClN3O2/c23-18-13-11-17(12-14-18)21(27)25-19(15-7-3-1-4-8-15)22(28)26-20(24)16-9-5-2-6-10-16/h1-14,19H,(H,25,27)(H2,24,26,28) |
| InChIKey | FSGMSXNCOVNKMR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.86 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|