C20H14BrCl2N3O3 — CID 121264477
N-[2-[[amino(phenyl)methylidene]amino]-1-(3,4-dichlorophenyl)-2-oxoethyl]-4-bromofuran-2-carboxamide (PubChem CID 121264477) has the molecular formula C20H14BrCl2N3O3 and a molecular weight of 495.16 g/mol. Its IUPAC name is N-[2-[[amino(phenyl)methylidene]amino]-1-(3,4-dichlorophenyl)-2-oxoethyl]-4-bromofuran-2-carboxamide.
| Compound Name | N-[2-[[amino(phenyl)methylidene]amino]-1-(3,4-dichlorophenyl)-2-oxoethyl]-4-bromofuran-2-carboxamide |
|---|---|
| PubChem CID | 121264477 |
| Molecular Formula | C20H14BrCl2N3O3 |
| Molecular Weight | 495.16 g/mol |
| Exact Mass | 492.96 |
| IUPAC Name | N-[2-[[amino(phenyl)methylidene]amino]-1-(3,4-dichlorophenyl)-2-oxoethyl]-4-bromofuran-2-carboxamide |
| SMILES | N/C(=N\C(=O)C(NC(=O)c1cc(Br)co1)c1ccc(Cl)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C20H14BrCl2N3O3/c21-13-9-16(29-10-13)19(27)25-17(12-6-7-14(22)15(23)8-12)20(28)26-18(24)11-4-2-1-3-5-11/h1-10,17H,(H,25,27)(H2,24,26,28) |
| InChIKey | XXPWBHCDEBIDSO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.16 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|