C26H20Cl2NO2P — CID 101360126
2-(3,4-dichlorophenyl)-2-(diphenylphosphorylamino)-1-phenylethanone (PubChem CID 101360126) has the molecular formula C26H20Cl2NO2P and a molecular weight of 480.33 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-2-(diphenylphosphorylamino)-1-phenylethanone.
| Compound Name | 2-(3,4-dichlorophenyl)-2-(diphenylphosphorylamino)-1-phenylethanone |
|---|---|
| PubChem CID | 101360126 |
| Molecular Formula | C26H20Cl2NO2P |
| Molecular Weight | 480.33 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-2-(diphenylphosphorylamino)-1-phenylethanone |
| SMILES | O=C(c1ccccc1)C(NP(=O)(c1ccccc1)c1ccccc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H20Cl2NO2P/c27-23-17-16-20(18-24(23)28)25(26(30)19-10-4-1-5-11-19)29-32(31,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-18,25H,(H,29,31) |
| InChIKey | ASMVPWSMNDGURO-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.33 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|