C17H17Cl2NO — CID 22405750
N-[2-(3,4-dichlorophenyl)propyl]-N-methylbenzamide (PubChem CID 22405750) has the molecular formula C17H17Cl2NO and a molecular weight of 322.24 g/mol. Its IUPAC name is N-[2-(3,4-dichlorophenyl)propyl]-N-methylbenzamide.
| Compound Name | N-[2-(3,4-dichlorophenyl)propyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 22405750 |
| Molecular Formula | C17H17Cl2NO |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | N-[2-(3,4-dichlorophenyl)propyl]-N-methylbenzamide |
| SMILES | CC(CN(C)C(=O)c1ccccc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H17Cl2NO/c1-12(14-8-9-15(18)16(19)10-14)11-20(2)17(21)13-6-4-3-5-7-13/h3-10,12H,11H2,1-2H3 |
| InChIKey | WYUGKNZFUKQLTA-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |