C18H17Cl2NO — CID 19066418
N-[2-(3,4-dichlorophenyl)but-3-enyl]-N-methylbenzamide (PubChem CID 19066418) has the molecular formula C18H17Cl2NO and a molecular weight of 334.25 g/mol. Its IUPAC name is N-[2-(3,4-dichlorophenyl)but-3-enyl]-N-methylbenzamide.
| Compound Name | N-[2-(3,4-dichlorophenyl)but-3-enyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 19066418 |
| Molecular Formula | C18H17Cl2NO |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | N-[2-(3,4-dichlorophenyl)but-3-enyl]-N-methylbenzamide |
| SMILES | C=CC(CN(C)C(=O)c1ccccc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H17Cl2NO/c1-3-13(15-9-10-16(19)17(20)11-15)12-21(2)18(22)14-7-5-4-6-8-14/h3-11,13H,1,12H2,2H3 |
| InChIKey | YXNGVTZMWRGCST-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|