C21H24Cl3NO2 — CID 70615154
5-(3,4-dichlorophenyl)-6-(dimethylamino)-3-phenylhept-2-enoic acid;hydrochloride (PubChem CID 70615154) has the molecular formula C21H24Cl3NO2 and a molecular weight of 428.79 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-6-(dimethylamino)-3-phenylhept-2-enoic acid;hydrochloride.
| Compound Name | 5-(3,4-dichlorophenyl)-6-(dimethylamino)-3-phenylhept-2-enoic acid;hydrochloride |
|---|---|
| PubChem CID | 70615154 |
| Molecular Formula | C21H24Cl3NO2 |
| Molecular Weight | 428.79 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-6-(dimethylamino)-3-phenylhept-2-enoic acid;hydrochloride |
| SMILES | CC(C(CC(=CC(=O)O)c1ccccc1)c1ccc(Cl)c(Cl)c1)N(C)C.Cl |
| InChI | InChI=1S/C21H23Cl2NO2.ClH/c1-14(24(2)3)18(16-9-10-19(22)20(23)12-16)11-17(13-21(25)26)15-7-5-4-6-8-15;/h4-10,12-14,18H,11H2,1-3H3,(H,25,26);1H |
| InChIKey | HWTUEXVZTZFHCM-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.79 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|