C16H15Cl2NO3 — CID 118675734
[(2S,3R)-2-(3,4-dichlorophenyl)-3-hydroxy-3-phenylpropyl]carbamic acid (PubChem CID 118675734) has the molecular formula C16H15Cl2NO3 and a molecular weight of 340.21 g/mol. Its IUPAC name is [(2S,3R)-2-(3,4-dichlorophenyl)-3-hydroxy-3-phenylpropyl]carbamic acid.
| Compound Name | [(2S,3R)-2-(3,4-dichlorophenyl)-3-hydroxy-3-phenylpropyl]carbamic acid |
|---|---|
| PubChem CID | 118675734 |
| Molecular Formula | C16H15Cl2NO3 |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | [(2S,3R)-2-(3,4-dichlorophenyl)-3-hydroxy-3-phenylpropyl]carbamic acid |
| SMILES | O=C(O)NC[C@H](c1ccc(Cl)c(Cl)c1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C16H15Cl2NO3/c17-13-7-6-11(8-14(13)18)12(9-19-16(21)22)15(20)10-4-2-1-3-5-10/h1-8,12,15,19-20H,9H2,(H,21,22)/t12-,15+/m1/s1 |
| InChIKey | XMOCMDJLPANCEB-DOMZBBRYSA-N |
| XLogP | 4.08 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |