C16H16BrCl2NO — CID 118675472
1-(3-bromophenyl)-2-(3,4-dichlorophenyl)-3-(methylamino)propan-1-ol (PubChem CID 118675472) has the molecular formula C16H16BrCl2NO and a molecular weight of 389.12 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2-(3,4-dichlorophenyl)-3-(methylamino)propan-1-ol.
| Compound Name | 1-(3-bromophenyl)-2-(3,4-dichlorophenyl)-3-(methylamino)propan-1-ol |
|---|---|
| PubChem CID | 118675472 |
| Molecular Formula | C16H16BrCl2NO |
| Molecular Weight | 389.12 g/mol |
| Exact Mass | 386.98 |
| IUPAC Name | 1-(3-bromophenyl)-2-(3,4-dichlorophenyl)-3-(methylamino)propan-1-ol |
| SMILES | CNCC(c1ccc(Cl)c(Cl)c1)C(O)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H16BrCl2NO/c1-20-9-13(10-5-6-14(18)15(19)8-10)16(21)11-3-2-4-12(17)7-11/h2-8,13,16,20-21H,9H2,1H3 |
| InChIKey | NGXVLKNIKQVIQZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.12 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |