C18H20ClNO3 — CID 118675481
ethyl N-[2-(4-chlorophenyl)-3-hydroxy-3-phenylpropyl]carbamate (PubChem CID 118675481) has the molecular formula C18H20ClNO3 and a molecular weight of 333.82 g/mol. Its IUPAC name is ethyl N-[2-(4-chlorophenyl)-3-hydroxy-3-phenylpropyl]carbamate.
| Compound Name | ethyl N-[2-(4-chlorophenyl)-3-hydroxy-3-phenylpropyl]carbamate |
|---|---|
| PubChem CID | 118675481 |
| Molecular Formula | C18H20ClNO3 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | ethyl N-[2-(4-chlorophenyl)-3-hydroxy-3-phenylpropyl]carbamate |
| SMILES | CCOC(=O)NCC(c1ccc(Cl)cc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C18H20ClNO3/c1-2-23-18(22)20-12-16(13-8-10-15(19)11-9-13)17(21)14-6-4-3-5-7-14/h3-11,16-17,21H,2,12H2,1H3,(H,20,22) |
| InChIKey | PMHPBPLEBRPTLI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |