C14H20ClNO4 — CID 170831537
tert-butyl N-[3-(4-chlorophenyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 170831537) has the molecular formula C14H20ClNO4 and a molecular weight of 301.77 g/mol. Its IUPAC name is tert-butyl N-[3-(4-chlorophenyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-chlorophenyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 170831537 |
| Molecular Formula | C14H20ClNO4 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | tert-butyl N-[3-(4-chlorophenyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(O)C(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H20ClNO4/c1-14(2,3)20-13(19)16-8-11(17)12(18)9-4-6-10(15)7-5-9/h4-7,11-12,17-18H,8H2,1-3H3,(H,16,19) |
| InChIKey | ZYDMNTYXMQSIEB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |