C16H26N2O4 — CID 170832177
tert-butyl N-[3-[4-(dimethylamino)phenyl]-2,3-dihydroxypropyl]carbamate (PubChem CID 170832177) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is tert-butyl N-[3-[4-(dimethylamino)phenyl]-2,3-dihydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-(dimethylamino)phenyl]-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 170832177 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | tert-butyl N-[3-[4-(dimethylamino)phenyl]-2,3-dihydroxypropyl]carbamate |
| SMILES | CN(C)c1ccc(C(O)C(O)CNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H26N2O4/c1-16(2,3)22-15(21)17-10-13(19)14(20)11-6-8-12(9-7-11)18(4)5/h6-9,13-14,19-20H,10H2,1-5H3,(H,17,21) |
| InChIKey | ZMSDXGWDIGAPTB-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|