C12H19N3O4 — CID 170831522
tert-butyl N-(2,3-dihydroxy-3-pyrimidin-2-ylpropyl)carbamate (PubChem CID 170831522) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is tert-butyl N-(2,3-dihydroxy-3-pyrimidin-2-ylpropyl)carbamate.
| Compound Name | tert-butyl N-(2,3-dihydroxy-3-pyrimidin-2-ylpropyl)carbamate |
|---|---|
| PubChem CID | 170831522 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | tert-butyl N-(2,3-dihydroxy-3-pyrimidin-2-ylpropyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(O)C(O)c1ncccn1 |
| InChI | InChI=1S/C12H19N3O4/c1-12(2,3)19-11(18)15-7-8(16)9(17)10-13-5-4-6-14-10/h4-6,8-9,16-17H,7H2,1-3H3,(H,15,18) |
| InChIKey | AASDULSHFDAWKV-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |