C14H21NO6 — CID 170833404
tert-butyl N-[3-(2,3-dihydroxyphenyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 170833404) has the molecular formula C14H21NO6 and a molecular weight of 299.32 g/mol. Its IUPAC name is tert-butyl N-[3-(2,3-dihydroxyphenyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-(2,3-dihydroxyphenyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 170833404 |
| Molecular Formula | C14H21NO6 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | tert-butyl N-[3-(2,3-dihydroxyphenyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(O)C(O)c1cccc(O)c1O |
| InChI | InChI=1S/C14H21NO6/c1-14(2,3)21-13(20)15-7-10(17)12(19)8-5-4-6-9(16)11(8)18/h4-6,10,12,16-19H,7H2,1-3H3,(H,15,20) |
| InChIKey | IQFQRZUSXHQIQF-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|