C15H22BrNO4 — CID 170833181
tert-butyl N-[3-[2-(bromomethyl)phenyl]-2,3-dihydroxypropyl]carbamate (PubChem CID 170833181) has the molecular formula C15H22BrNO4 and a molecular weight of 360.25 g/mol. Its IUPAC name is tert-butyl N-[3-[2-(bromomethyl)phenyl]-2,3-dihydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-(bromomethyl)phenyl]-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 170833181 |
| Molecular Formula | C15H22BrNO4 |
| Molecular Weight | 360.25 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | tert-butyl N-[3-[2-(bromomethyl)phenyl]-2,3-dihydroxypropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(O)C(O)c1ccccc1CBr |
| InChI | InChI=1S/C15H22BrNO4/c1-15(2,3)21-14(20)17-9-12(18)13(19)11-7-5-4-6-10(11)8-16/h4-7,12-13,18-19H,8-9H2,1-3H3,(H,17,20) |
| InChIKey | JGZWAPVOKQCHLC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.25 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|