C14H21NO5 — CID 170831552
tert-butyl N-[2,3-dihydroxy-3-(3-hydroxyphenyl)propyl]carbamate (PubChem CID 170831552) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is tert-butyl N-[2,3-dihydroxy-3-(3-hydroxyphenyl)propyl]carbamate.
| Compound Name | tert-butyl N-[2,3-dihydroxy-3-(3-hydroxyphenyl)propyl]carbamate |
|---|---|
| PubChem CID | 170831552 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | tert-butyl N-[2,3-dihydroxy-3-(3-hydroxyphenyl)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(O)C(O)c1cccc(O)c1 |
| InChI | InChI=1S/C14H21NO5/c1-14(2,3)20-13(19)15-8-11(17)12(18)9-5-4-6-10(16)7-9/h4-7,11-12,16-18H,8H2,1-3H3,(H,15,19) |
| InChIKey | RISNHIGGWHWIPP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |