C21H23NO5 — CID 170833141
tert-butyl N-[2,3-dihydroxy-3-(9-oxofluoren-2-yl)propyl]carbamate (PubChem CID 170833141) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is tert-butyl N-[2,3-dihydroxy-3-(9-oxofluoren-2-yl)propyl]carbamate.
| Compound Name | tert-butyl N-[2,3-dihydroxy-3-(9-oxofluoren-2-yl)propyl]carbamate |
|---|---|
| PubChem CID | 170833141 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | tert-butyl N-[2,3-dihydroxy-3-(9-oxofluoren-2-yl)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(O)C(O)c1ccc2c(c1)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C21H23NO5/c1-21(2,3)27-20(26)22-11-17(23)18(24)12-8-9-14-13-6-4-5-7-15(13)19(25)16(14)10-12/h4-10,17-18,23-24H,11H2,1-3H3,(H,22,26) |
| InChIKey | TZOVYXFQYJJMLZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |