C16H20N2O6 — CID 170832899
tert-butyl N-[3-(1,3-dioxoisoindol-5-yl)-2,3-dihydroxypropyl]carbamate (PubChem CID 170832899) has the molecular formula C16H20N2O6 and a molecular weight of 336.34 g/mol. Its IUPAC name is tert-butyl N-[3-(1,3-dioxoisoindol-5-yl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-(1,3-dioxoisoindol-5-yl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 170832899 |
| Molecular Formula | C16H20N2O6 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | tert-butyl N-[3-(1,3-dioxoisoindol-5-yl)-2,3-dihydroxypropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(O)C(O)c1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C16H20N2O6/c1-16(2,3)24-15(23)17-7-11(19)12(20)8-4-5-9-10(6-8)14(22)18-13(9)21/h4-6,11-12,19-20H,7H2,1-3H3,(H,17,23)(H,18,21,22) |
| InChIKey | NAAWTLDEUVMFCG-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|