C15H21N3O4 — CID 170832269
tert-butyl N-[2,3-dihydroxy-3-(1H-indazol-5-yl)propyl]carbamate (PubChem CID 170832269) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is tert-butyl N-[2,3-dihydroxy-3-(1H-indazol-5-yl)propyl]carbamate.
| Compound Name | tert-butyl N-[2,3-dihydroxy-3-(1H-indazol-5-yl)propyl]carbamate |
|---|---|
| PubChem CID | 170832269 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | tert-butyl N-[2,3-dihydroxy-3-(1H-indazol-5-yl)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(O)C(O)c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C15H21N3O4/c1-15(2,3)22-14(21)16-8-12(19)13(20)9-4-5-11-10(6-9)7-17-18-11/h4-7,12-13,19-20H,8H2,1-3H3,(H,16,21)(H,17,18) |
| InChIKey | CNXJBZRCUBFPFI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 107.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |