C13H19BrN2O4 — CID 170833174
tert-butyl N-[3-(5-bromo-2-pyridinyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 170833174) has the molecular formula C13H19BrN2O4 and a molecular weight of 347.21 g/mol. Its IUPAC name is tert-butyl N-[3-(5-bromo-2-pyridinyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-(5-bromo-2-pyridinyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 170833174 |
| Molecular Formula | C13H19BrN2O4 |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | tert-butyl N-[3-(5-bromo-2-pyridinyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(O)C(O)c1ccc(Br)cn1 |
| InChI | InChI=1S/C13H19BrN2O4/c1-13(2,3)20-12(19)16-7-10(17)11(18)9-5-4-8(14)6-15-9/h4-6,10-11,17-18H,7H2,1-3H3,(H,16,19) |
| InChIKey | ZRQLIMYKEFSIGX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |