C18H30BrN3O5 — CID 177054913
tert-butyl N-[2-[2-[2-[2-[(5-bromo-2-pyridinyl)amino]ethoxy]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 177054913) has the molecular formula C18H30BrN3O5 and a molecular weight of 448.36 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[2-[(5-bromo-2-pyridinyl)amino]ethoxy]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[2-[(5-bromo-2-pyridinyl)amino]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 177054913 |
| Molecular Formula | C18H30BrN3O5 |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[2-[(5-bromo-2-pyridinyl)amino]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCNc1ccc(Br)cn1 |
| InChI | InChI=1S/C18H30BrN3O5/c1-18(2,3)27-17(23)21-7-9-25-11-13-26-12-10-24-8-6-20-16-5-4-15(19)14-22-16/h4-5,14H,6-13H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | CZLYVHDRPOLZND-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|