C12H17BrN2O2S — CID 146021302
tert-butyl N-[2-[(5-bromo-2-pyridinyl)sulfanyl]ethyl]carbamate (PubChem CID 146021302) has the molecular formula C12H17BrN2O2S and a molecular weight of 333.25 g/mol. Its IUPAC name is tert-butyl N-[2-[(5-bromo-2-pyridinyl)sulfanyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(5-bromo-2-pyridinyl)sulfanyl]ethyl]carbamate |
|---|---|
| PubChem CID | 146021302 |
| Molecular Formula | C12H17BrN2O2S |
| Molecular Weight | 333.25 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | tert-butyl N-[2-[(5-bromo-2-pyridinyl)sulfanyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCSc1ccc(Br)cn1 |
| InChI | InChI=1S/C12H17BrN2O2S/c1-12(2,3)17-11(16)14-6-7-18-10-5-4-9(13)8-15-10/h4-5,8H,6-7H2,1-3H3,(H,14,16) |
| InChIKey | QOPBPMYPYLAXNG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.25 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|