C15H24N2O2S — CID 102546900
tert-butyl N-[(6-tert-butylsulfanyl-3-pyridinyl)methyl]carbamate (PubChem CID 102546900) has the molecular formula C15H24N2O2S and a molecular weight of 296.44 g/mol. Its IUPAC name is tert-butyl N-[(6-tert-butylsulfanyl-3-pyridinyl)methyl]carbamate.
| Compound Name | tert-butyl N-[(6-tert-butylsulfanyl-3-pyridinyl)methyl]carbamate |
|---|---|
| PubChem CID | 102546900 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | tert-butyl N-[(6-tert-butylsulfanyl-3-pyridinyl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(SC(C)(C)C)nc1 |
| InChI | InChI=1S/C15H24N2O2S/c1-14(2,3)19-13(18)17-10-11-7-8-12(16-9-11)20-15(4,5)6/h7-9H,10H2,1-6H3,(H,17,18) |
| InChIKey | SRHKOVDGOSTFOE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |