C14H21N3O2 — CID 67390801
tert-butyl N-[[6-(1-aminocyclopropyl)-3-pyridinyl]methyl]carbamate (PubChem CID 67390801) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is tert-butyl N-[[6-(1-aminocyclopropyl)-3-pyridinyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[6-(1-aminocyclopropyl)-3-pyridinyl]methyl]carbamate |
|---|---|
| PubChem CID | 67390801 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | tert-butyl N-[[6-(1-aminocyclopropyl)-3-pyridinyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(C2(N)CC2)nc1 |
| InChI | InChI=1S/C14H21N3O2/c1-13(2,3)19-12(18)17-9-10-4-5-11(16-8-10)14(15)6-7-14/h4-5,8H,6-7,9,15H2,1-3H3,(H,17,18) |
| InChIKey | BRXFFJQIRAPDPP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |