C10H14N2 — CID 91548907
1-(5-ethyl-2-pyridinyl)cyclopropan-1-amine (PubChem CID 91548907) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 1-(5-ethyl-2-pyridinyl)cyclopropan-1-amine.
| Compound Name | 1-(5-ethyl-2-pyridinyl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 91548907 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 1-(5-ethyl-2-pyridinyl)cyclopropan-1-amine |
| SMILES | CCc1ccc(C2(N)CC2)nc1 |
| InChI | InChI=1S/C10H14N2/c1-2-8-3-4-9(12-7-8)10(11)5-6-10/h3-4,7H,2,5-6,11H2,1H3 |
| InChIKey | OYTDJXIRMBEVNA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |