C16H25BrN2O3 — CID 146014726
tert-butyl N-[(6-bromo-3-pyridinyl)methyl]carbamate;oxane (PubChem CID 146014726) has the molecular formula C16H25BrN2O3 and a molecular weight of 373.29 g/mol. Its IUPAC name is tert-butyl N-[(6-bromo-3-pyridinyl)methyl]carbamate;oxane.
| Compound Name | tert-butyl N-[(6-bromo-3-pyridinyl)methyl]carbamate;oxane |
|---|---|
| PubChem CID | 146014726 |
| Molecular Formula | C16H25BrN2O3 |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | tert-butyl N-[(6-bromo-3-pyridinyl)methyl]carbamate;oxane |
| SMILES | C1CCOCC1.CC(C)(C)OC(=O)NCc1ccc(Br)nc1 |
| InChI | InChI=1S/C11H15BrN2O2.C5H10O/c1-11(2,3)16-10(15)14-7-8-4-5-9(12)13-6-8;1-2-4-6-5-3-1/h4-6H,7H2,1-3H3,(H,14,15);1-5H2 |
| InChIKey | MPFSVUSBZDUZMJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|