C12H18N2O2S — CID 102546552
tert-butyl N-[(6-methylsulfanyl-3-pyridinyl)methyl]carbamate (PubChem CID 102546552) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is tert-butyl N-[(6-methylsulfanyl-3-pyridinyl)methyl]carbamate.
| Compound Name | tert-butyl N-[(6-methylsulfanyl-3-pyridinyl)methyl]carbamate |
|---|---|
| PubChem CID | 102546552 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | tert-butyl N-[(6-methylsulfanyl-3-pyridinyl)methyl]carbamate |
| SMILES | CSc1ccc(CNC(=O)OC(C)(C)C)cn1 |
| InChI | InChI=1S/C12H18N2O2S/c1-12(2,3)16-11(15)14-8-9-5-6-10(17-4)13-7-9/h5-7H,8H2,1-4H3,(H,14,15) |
| InChIKey | LAOHUAAEOKVJGJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |