C11H14N4O2 — CID 22476025
tert-butyl N-[(2-cyanopyrimidin-5-yl)methyl]carbamate (PubChem CID 22476025) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is tert-butyl N-[(2-cyanopyrimidin-5-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(2-cyanopyrimidin-5-yl)methyl]carbamate |
|---|---|
| PubChem CID | 22476025 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | tert-butyl N-[(2-cyanopyrimidin-5-yl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cnc(C#N)nc1 |
| InChI | InChI=1S/C11H14N4O2/c1-11(2,3)17-10(16)15-7-8-5-13-9(4-12)14-6-8/h5-6H,7H2,1-3H3,(H,15,16) |
| InChIKey | CTZOJSVMLQRBHR-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |