C10H14BrN3O2 — CID 90190519
tert-butyl N-[(5-bromo-2-pyridinyl)amino]carbamate (PubChem CID 90190519) has the molecular formula C10H14BrN3O2 and a molecular weight of 288.14 g/mol. Its IUPAC name is tert-butyl N-[(5-bromo-2-pyridinyl)amino]carbamate.
| Compound Name | tert-butyl N-[(5-bromo-2-pyridinyl)amino]carbamate |
|---|---|
| PubChem CID | 90190519 |
| Molecular Formula | C10H14BrN3O2 |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | tert-butyl N-[(5-bromo-2-pyridinyl)amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNc1ccc(Br)cn1 |
| InChI | InChI=1S/C10H14BrN3O2/c1-10(2,3)16-9(15)14-13-8-5-4-7(11)6-12-8/h4-6H,1-3H3,(H,12,13)(H,14,15) |
| InChIKey | IGGSFPSFRGFATM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|