C17H29N5O3 — CID 10991747
tert-butyl N-[[5-[2-(diethylamino)ethylcarbamoyl]-2-pyridinyl]amino]carbamate (PubChem CID 10991747) has the molecular formula C17H29N5O3 and a molecular weight of 351.45 g/mol. Its IUPAC name is tert-butyl N-[[5-[2-(diethylamino)ethylcarbamoyl]-2-pyridinyl]amino]carbamate.
| Compound Name | tert-butyl N-[[5-[2-(diethylamino)ethylcarbamoyl]-2-pyridinyl]amino]carbamate |
|---|---|
| PubChem CID | 10991747 |
| Molecular Formula | C17H29N5O3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | tert-butyl N-[[5-[2-(diethylamino)ethylcarbamoyl]-2-pyridinyl]amino]carbamate |
| SMILES | CCN(CC)CCNC(=O)c1ccc(NNC(=O)OC(C)(C)C)nc1 |
| InChI | InChI=1S/C17H29N5O3/c1-6-22(7-2)11-10-18-15(23)13-8-9-14(19-12-13)20-21-16(24)25-17(3,4)5/h8-9,12H,6-7,10-11H2,1-5H3,(H,18,23)(H,19,20)(H,21,24) |
| InChIKey | QLMFJIZSUMJKPL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|