C63H24N4O5 — CID 165085099
tert-butyl N-[[5-[[3,4-bis(docosa-1,3,5,7,9,11,13,15,17,19,21-undecaynoxy)-5-methylphenyl]methylcarbamoyl]-2-pyridinyl]amino]carbamate (PubChem CID 165085099) has the molecular formula C63H24N4O5 and a molecular weight of 916.91 g/mol. Its IUPAC name is tert-butyl N-[[5-[[3,4-bis(docosa-1,3,5,7,9,11,13,15,17,19,21-undecaynoxy)-5-methylphenyl]methylcarbamoyl]-2-pyridinyl]amino]carbamate.
| Compound Name | tert-butyl N-[[5-[[3,4-bis(docosa-1,3,5,7,9,11,13,15,17,19,21-undecaynoxy)-5-methylphenyl]methylcarbamoyl]-2-pyridinyl]amino]carbamate |
|---|---|
| PubChem CID | 165085099 |
| Molecular Formula | C63H24N4O5 |
| Molecular Weight | 916.91 g/mol |
| Exact Mass | 916.17 |
| IUPAC Name | tert-butyl N-[[5-[[3,4-bis(docosa-1,3,5,7,9,11,13,15,17,19,21-undecaynoxy)-5-methylphenyl]methylcarbamoyl]-2-pyridinyl]amino]carbamate |
| SMILES | C#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#COc1cc(CNC(=O)c2ccc(NNC(=O)OC(C)(C)C)nc2)cc(C)c1OC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#C |
| InChI | InChI=1S/C63H24N4O5/c1-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-41-43-45-49-70-58-52-56(53-65-61(68)57-47-48-59(64-54-57)66-67-62(69)72-63(4,5)6)51-55(3)60(58)71-50-46-44-42-40-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-2/h1-2,47-48,51-52,54H,53H2,3-6H3,(H,64,66)(H,65,68)(H,67,69) |
| InChIKey | LFCOCUKAXXEDGQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 110.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 72 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 916.91 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|