C19H23N3O3 — CID 17476260
tert-butyl N-[[4-[(5-methyl-2-pyridinyl)carbamoyl]phenyl]methyl]carbamate (PubChem CID 17476260) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is tert-butyl N-[[4-[(5-methyl-2-pyridinyl)carbamoyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[(5-methyl-2-pyridinyl)carbamoyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 17476260 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | tert-butyl N-[[4-[(5-methyl-2-pyridinyl)carbamoyl]phenyl]methyl]carbamate |
| SMILES | Cc1ccc(NC(=O)c2ccc(CNC(=O)OC(C)(C)C)cc2)nc1 |
| InChI | InChI=1S/C19H23N3O3/c1-13-5-10-16(20-11-13)22-17(23)15-8-6-14(7-9-15)12-21-18(24)25-19(2,3)4/h5-11H,12H2,1-4H3,(H,21,24)(H,20,22,23) |
| InChIKey | WGXDLXANMYEOKP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |