C17H22N4O3 — CID 71940520
tert-butyl N-[[4-[(5-methyl-1H-pyrazol-3-yl)carbamoyl]phenyl]methyl]carbamate (PubChem CID 71940520) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is tert-butyl N-[[4-[(5-methyl-1H-pyrazol-3-yl)carbamoyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[(5-methyl-1H-pyrazol-3-yl)carbamoyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 71940520 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | tert-butyl N-[[4-[(5-methyl-1H-pyrazol-3-yl)carbamoyl]phenyl]methyl]carbamate |
| SMILES | Cc1cc(NC(=O)c2ccc(CNC(=O)OC(C)(C)C)cc2)n[nH]1 |
| InChI | InChI=1S/C17H22N4O3/c1-11-9-14(21-20-11)19-15(22)13-7-5-12(6-8-13)10-18-16(23)24-17(2,3)4/h5-9H,10H2,1-4H3,(H,18,23)(H2,19,20,21,22) |
| InChIKey | FYVZQSFFZYDYLP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |