C19H20F2N2O3 — CID 9078733
tert-butyl N-[[4-[(2,4-difluorophenyl)carbamoyl]phenyl]methyl]carbamate (PubChem CID 9078733) has the molecular formula C19H20F2N2O3 and a molecular weight of 362.38 g/mol. Its IUPAC name is tert-butyl N-[[4-[(2,4-difluorophenyl)carbamoyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[(2,4-difluorophenyl)carbamoyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 9078733 |
| Molecular Formula | C19H20F2N2O3 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | tert-butyl N-[[4-[(2,4-difluorophenyl)carbamoyl]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(C(=O)Nc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C19H20F2N2O3/c1-19(2,3)26-18(25)22-11-12-4-6-13(7-5-12)17(24)23-16-9-8-14(20)10-15(16)21/h4-10H,11H2,1-3H3,(H,22,25)(H,23,24) |
| InChIKey | VYOHSHHNISMMGP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |