C21H24N2O6 — CID 163196860
4-methoxy-3-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoyl]amino]benzoic acid (PubChem CID 163196860) has the molecular formula C21H24N2O6 and a molecular weight of 400.43 g/mol. Its IUPAC name is 4-methoxy-3-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoyl]amino]benzoic acid.
| Compound Name | 4-methoxy-3-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 163196860 |
| Molecular Formula | C21H24N2O6 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 4-methoxy-3-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoyl]amino]benzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1NC(=O)c1ccc(CNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H24N2O6/c1-21(2,3)29-20(27)22-12-13-5-7-14(8-6-13)18(24)23-16-11-15(19(25)26)9-10-17(16)28-4/h5-11H,12H2,1-4H3,(H,22,27)(H,23,24)(H,25,26) |
| InChIKey | FZIKXOGTWBIKKU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |