C15H21ClN2O4 — CID 166419727
tert-butyl N-[5-[[(2-chloroacetyl)amino]methyl]-2-methoxyphenyl]carbamate (PubChem CID 166419727) has the molecular formula C15H21ClN2O4 and a molecular weight of 328.80 g/mol. Its IUPAC name is tert-butyl N-[5-[[(2-chloroacetyl)amino]methyl]-2-methoxyphenyl]carbamate.
| Compound Name | tert-butyl N-[5-[[(2-chloroacetyl)amino]methyl]-2-methoxyphenyl]carbamate |
|---|---|
| PubChem CID | 166419727 |
| Molecular Formula | C15H21ClN2O4 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | tert-butyl N-[5-[[(2-chloroacetyl)amino]methyl]-2-methoxyphenyl]carbamate |
| SMILES | COc1ccc(CNC(=O)CCl)cc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H21ClN2O4/c1-15(2,3)22-14(20)18-11-7-10(5-6-12(11)21-4)9-17-13(19)8-16/h5-7H,8-9H2,1-4H3,(H,17,19)(H,18,20) |
| InChIKey | PCARHELPSLCUNR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|