C12H21N5O2S — CID 84554176
tert-butyl N-[2-[(5-methyl-1H-pyrazol-3-yl)carbamothioylamino]ethyl]carbamate (PubChem CID 84554176) has the molecular formula C12H21N5O2S and a molecular weight of 299.40 g/mol. Its IUPAC name is tert-butyl N-[2-[(5-methyl-1H-pyrazol-3-yl)carbamothioylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(5-methyl-1H-pyrazol-3-yl)carbamothioylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 84554176 |
| Molecular Formula | C12H21N5O2S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | tert-butyl N-[2-[(5-methyl-1H-pyrazol-3-yl)carbamothioylamino]ethyl]carbamate |
| SMILES | Cc1cc(NC(=S)NCCNC(=O)OC(C)(C)C)n[nH]1 |
| InChI | InChI=1S/C12H21N5O2S/c1-8-7-9(17-16-8)15-10(20)13-5-6-14-11(18)19-12(2,3)4/h7H,5-6H2,1-4H3,(H,14,18)(H3,13,15,16,17,20) |
| InChIKey | YVMPURJARWHNIR-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 91.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|