C18H28FN3O2S — CID 87779571
tert-butyl N-[6-[(4-fluorophenyl)carbamothioylamino]hexyl]carbamate (PubChem CID 87779571) has the molecular formula C18H28FN3O2S and a molecular weight of 369.51 g/mol. Its IUPAC name is tert-butyl N-[6-[(4-fluorophenyl)carbamothioylamino]hexyl]carbamate.
| Compound Name | tert-butyl N-[6-[(4-fluorophenyl)carbamothioylamino]hexyl]carbamate |
|---|---|
| PubChem CID | 87779571 |
| Molecular Formula | C18H28FN3O2S |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | tert-butyl N-[6-[(4-fluorophenyl)carbamothioylamino]hexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCCNC(=S)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C18H28FN3O2S/c1-18(2,3)24-17(23)21-13-7-5-4-6-12-20-16(25)22-15-10-8-14(19)9-11-15/h8-11H,4-7,12-13H2,1-3H3,(H,21,23)(H2,20,22,25) |
| InChIKey | HAELLMURLXNQQC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|