C19H23FN2O2 — CID 112983477
tert-butyl N-[4-[2-(4-fluorophenyl)ethylamino]phenyl]carbamate (PubChem CID 112983477) has the molecular formula C19H23FN2O2 and a molecular weight of 330.40 g/mol. Its IUPAC name is tert-butyl N-[4-[2-(4-fluorophenyl)ethylamino]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-(4-fluorophenyl)ethylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 112983477 |
| Molecular Formula | C19H23FN2O2 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | tert-butyl N-[4-[2-(4-fluorophenyl)ethylamino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(NCCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H23FN2O2/c1-19(2,3)24-18(23)22-17-10-8-16(9-11-17)21-13-12-14-4-6-15(20)7-5-14/h4-11,21H,12-13H2,1-3H3,(H,22,23) |
| InChIKey | ZYRQRACPYZVZFP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |