C24H24FNO3 — CID 155206873
tert-butyl N-[4-[[4-(4-fluorophenyl)phenyl]-hydroxymethyl]phenyl]carbamate (PubChem CID 155206873) has the molecular formula C24H24FNO3 and a molecular weight of 393.46 g/mol. Its IUPAC name is tert-butyl N-[4-[[4-(4-fluorophenyl)phenyl]-hydroxymethyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[[4-(4-fluorophenyl)phenyl]-hydroxymethyl]phenyl]carbamate |
|---|---|
| PubChem CID | 155206873 |
| Molecular Formula | C24H24FNO3 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | tert-butyl N-[4-[[4-(4-fluorophenyl)phenyl]-hydroxymethyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C(O)c2ccc(-c3ccc(F)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H24FNO3/c1-24(2,3)29-23(28)26-21-14-10-19(11-15-21)22(27)18-6-4-16(5-7-18)17-8-12-20(25)13-9-17/h4-15,22,27H,1-3H3,(H,26,28) |
| InChIKey | HYEOGMASHVNQQP-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |