C18H21NO4 — CID 53221133
tert-butyl N-[4-(3-hydroxy-4-methoxyphenyl)phenyl]carbamate (PubChem CID 53221133) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is tert-butyl N-[4-(3-hydroxy-4-methoxyphenyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-(3-hydroxy-4-methoxyphenyl)phenyl]carbamate |
|---|---|
| PubChem CID | 53221133 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | tert-butyl N-[4-(3-hydroxy-4-methoxyphenyl)phenyl]carbamate |
| SMILES | COc1ccc(-c2ccc(NC(=O)OC(C)(C)C)cc2)cc1O |
| InChI | InChI=1S/C18H21NO4/c1-18(2,3)23-17(21)19-14-8-5-12(6-9-14)13-7-10-16(22-4)15(20)11-13/h5-11,20H,1-4H3,(H,19,21) |
| InChIKey | VLEMYIHQCZHRTE-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |