C19H30N2O2S — CID 4505984
tert-butyl 4-[(4-tert-butylphenyl)carbamothioylamino]butanoate (PubChem CID 4505984) has the molecular formula C19H30N2O2S and a molecular weight of 350.53 g/mol. Its IUPAC name is tert-butyl 4-[(4-tert-butylphenyl)carbamothioylamino]butanoate.
| Compound Name | tert-butyl 4-[(4-tert-butylphenyl)carbamothioylamino]butanoate |
|---|---|
| PubChem CID | 4505984 |
| Molecular Formula | C19H30N2O2S |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | tert-butyl 4-[(4-tert-butylphenyl)carbamothioylamino]butanoate |
| SMILES | CC(C)(C)OC(=O)CCCNC(=S)Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H30N2O2S/c1-18(2,3)14-9-11-15(12-10-14)21-17(24)20-13-7-8-16(22)23-19(4,5)6/h9-12H,7-8,13H2,1-6H3,(H2,20,21,24) |
| InChIKey | DTNVOHACBWZEIS-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|