C18H29NO4S — CID 4988429
tert-butyl 4-[(4-tert-butylphenyl)sulfonylamino]butanoate (PubChem CID 4988429) has the molecular formula C18H29NO4S and a molecular weight of 355.50 g/mol. Its IUPAC name is tert-butyl 4-[(4-tert-butylphenyl)sulfonylamino]butanoate.
| Compound Name | tert-butyl 4-[(4-tert-butylphenyl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 4988429 |
| Molecular Formula | C18H29NO4S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | tert-butyl 4-[(4-tert-butylphenyl)sulfonylamino]butanoate |
| SMILES | CC(C)(C)OC(=O)CCCNS(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H29NO4S/c1-17(2,3)14-9-11-15(12-10-14)24(21,22)19-13-7-8-16(20)23-18(4,5)6/h9-12,19H,7-8,13H2,1-6H3 |
| InChIKey | MIPCAWFWSOXLLV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|